C22H24N2O4 — CID 169219769
3-[(7-cyclobutyloxy-4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid;ethane (PubChem CID 169219769) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 3-[(7-cyclobutyloxy-4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid;ethane.
| Compound Name | 3-[(7-cyclobutyloxy-4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid;ethane |
|---|---|
| PubChem CID | 169219769 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 3-[(7-cyclobutyloxy-4-oxo-3H-phthalazin-1-yl)methyl]benzoic acid;ethane |
| SMILES | CC.O=C(O)c1cccc(Cc2n[nH]c(=O)c3ccc(OC4CCC4)cc23)c1 |
| InChI | InChI=1S/C20H18N2O4.C2H6/c23-19-16-8-7-15(26-14-5-2-6-14)11-17(16)18(21-22-19)10-12-3-1-4-13(9-12)20(24)25;1-2/h1,3-4,7-9,11,14H,2,5-6,10H2,(H,22,23)(H,24,25);1-2H3 |
| InChIKey | LIOBSCMTAGPHPP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |