C24H25ClN4O3 — CID 169220345
4-[[2-chloro-3-(piperazine-1-carbonyl)phenyl]methyl]-6-cyclobutyloxy-2H-phthalazin-1-one (PubChem CID 169220345) has the molecular formula C24H25ClN4O3 and a molecular weight of 452.94 g/mol. Its IUPAC name is 4-[[2-chloro-3-(piperazine-1-carbonyl)phenyl]methyl]-6-cyclobutyloxy-2H-phthalazin-1-one.
| Compound Name | 4-[[2-chloro-3-(piperazine-1-carbonyl)phenyl]methyl]-6-cyclobutyloxy-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 169220345 |
| Molecular Formula | C24H25ClN4O3 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 4-[[2-chloro-3-(piperazine-1-carbonyl)phenyl]methyl]-6-cyclobutyloxy-2H-phthalazin-1-one |
| SMILES | O=C(c1cccc(Cc2n[nH]c(=O)c3ccc(OC4CCC4)cc23)c1Cl)N1CCNCC1 |
| InChI | InChI=1S/C24H25ClN4O3/c25-22-15(3-1-6-19(22)24(31)29-11-9-26-10-12-29)13-21-20-14-17(32-16-4-2-5-16)7-8-18(20)23(30)28-27-21/h1,3,6-8,14,16,26H,2,4-5,9-13H2,(H,28,30) |
| InChIKey | OHZCBOWGMFRMTJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |