About 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene
1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene (PubChem CID 145386274) has the molecular formula C24H32N2O3
and a molecular weight of 396.53 g/mol. Its IUPAC name is 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene.
Molecular Properties
| Compound Name | 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene |
| PubChem CID | 145386274 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene |
| SMILES | CCc1ccc(OC)cc1.CCc1cnc(OC)nc1.COc1ccc(C)cc1 |
| InChI | InChI=1S/C9H12O.C8H10O.C7H10N2O/c1-3-8-4-6-9(10-2)7-5-8;1-7-3-5-8(9-2)6-4-7;1-3-6-4-8-7(10-2)9-5-6/h4-7H,3H2,1-2H3;3-6H,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | FPTGAUDLHUEYDO-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene?
The IUPAC name of 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene (CID 145386274) is 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene.
What is the SMILES notation for 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene?
The canonical SMILES for 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene is CCc1ccc(OC)cc1.CCc1cnc(OC)nc1.COc1ccc(C)cc1.
What is the InChIKey of 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene?
The InChIKey is FPTGAUDLHUEYDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C8H10O.C7H10N2O/c1-3-8-4-6-9(10-2)7-5-8;1-7-3-5-8(9-2)6-4-7;1-3-6-4-8-7(10-2)9-5-6/h4-7H,3H2,1-2H3;3-6H,1-2H3;4-5H,3H2,1-2H3.
What are the key properties of 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene?
1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene has a molecular weight of 396.53 g/mol, XLogP of 5.31, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-methoxybenzene;5-ethyl-2-methoxypyrimidine;1-methoxy-4-methylbenzene is sourced from PubChem (CID 145386274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).