C28H34ClO4P — CID 145388446
chlorobenzene;4-[[4-(1,3,2-dioxaphosphinan-2-ylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol (PubChem CID 145388446) has the molecular formula C28H34ClO4P and a molecular weight of 501.00 g/mol. Its IUPAC name is chlorobenzene;4-[[4-(1,3,2-dioxaphosphinan-2-ylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol.
| Compound Name | chlorobenzene;4-[[4-(1,3,2-dioxaphosphinan-2-ylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol |
|---|---|
| PubChem CID | 145388446 |
| Molecular Formula | C28H34ClO4P |
| Molecular Weight | 501.00 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | chlorobenzene;4-[[4-(1,3,2-dioxaphosphinan-2-ylmethoxy)-2,6-dimethylphenyl]methyl]-2-propan-2-ylphenol |
| SMILES | Cc1cc(OCP2OCCCO2)cc(C)c1Cc1ccc(O)c(C(C)C)c1.Clc1ccccc1 |
| InChI | InChI=1S/C22H29O4P.C6H5Cl/c1-15(2)20-12-18(6-7-22(20)23)13-21-16(3)10-19(11-17(21)4)24-14-27-25-8-5-9-26-27;7-6-4-2-1-3-5-6/h6-7,10-12,15,23H,5,8-9,13-14H2,1-4H3;1-5H |
| InChIKey | ORWLQTRZSIGEKO-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.00 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|