C11H21N3O — CID 145391092
2,8-dimethyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;ethane (PubChem CID 145391092) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 2,8-dimethyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;ethane.
| Compound Name | 2,8-dimethyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;ethane |
|---|---|
| PubChem CID | 145391092 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 2,8-dimethyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one;ethane |
| SMILES | CC.CC1=NC2(CCN(C)CC2)C(=O)N1 |
| InChI | InChI=1S/C9H15N3O.C2H6/c1-7-10-8(13)9(11-7)3-5-12(2)6-4-9;1-2/h3-6H2,1-2H3,(H,10,11,13);1-2H3 |
| InChIKey | FNWGCRIXKANEEE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |