C9H15N3O — CID 20622667
8-ethyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 20622667) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 8-ethyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 8-ethyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 20622667 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 8-ethyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CCN1CCC2(CC1)N=CNC2=O |
| InChI | InChI=1S/C9H15N3O/c1-2-12-5-3-9(4-6-12)8(13)10-7-11-9/h7H,2-6H2,1H3,(H,10,11,13) |
| InChIKey | QFUNVLCYOVXJIO-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |