C10H17N3O — CID 22097505
3-ethyl-8-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 22097505) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-ethyl-8-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 3-ethyl-8-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 22097505 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-ethyl-8-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CCN1C=NC2(CCN(C)CC2)C1=O |
| InChI | InChI=1S/C10H17N3O/c1-3-13-8-11-10(9(13)14)4-6-12(2)7-5-10/h8H,3-7H2,1-2H3 |
| InChIKey | BLSUNHNPQHEFGK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |