C8H13N3O — CID 22975678
3-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 22975678) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | 3-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 22975678 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | CN1C=NC2(CCNCC2)C1=O |
| InChI | InChI=1S/C8H13N3O/c1-11-6-10-8(7(11)12)2-4-9-5-3-8/h6,9H,2-5H2,1H3 |
| InChIKey | OKZHJSOAAHLBBI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |