C20H18N4 — CID 145391350
5-imino-N,7-diphenyl-7,8-dihydro-6H-quinazolin-2-amine (PubChem CID 145391350) has the molecular formula C20H18N4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-imino-N,7-diphenyl-7,8-dihydro-6H-quinazolin-2-amine.
| Compound Name | 5-imino-N,7-diphenyl-7,8-dihydro-6H-quinazolin-2-amine |
|---|---|
| PubChem CID | 145391350 |
| Molecular Formula | C20H18N4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 5-imino-N,7-diphenyl-7,8-dihydro-6H-quinazolin-2-amine |
| SMILES | [H]/N=C1\CC(c2ccccc2)Cc2nc(Nc3ccccc3)ncc21 |
| InChI | InChI=1S/C20H18N4/c21-18-11-15(14-7-3-1-4-8-14)12-19-17(18)13-22-20(24-19)23-16-9-5-2-6-10-16/h1-10,13,15,21H,11-12H2,(H,22,23,24)/b21-18+ |
| InChIKey | FUICEFUKGXGIQP-DYTRJAOYSA-N |
| XLogP | 4.32 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|