C29H30Cl2N2O2 — CID 145391971
4-[4-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]phenyl]-2-ethenylaniline;ethane (PubChem CID 145391971) has the molecular formula C29H30Cl2N2O2 and a molecular weight of 509.48 g/mol. Its IUPAC name is 4-[4-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]phenyl]-2-ethenylaniline;ethane.
| Compound Name | 4-[4-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]phenyl]-2-ethenylaniline;ethane |
|---|---|
| PubChem CID | 145391971 |
| Molecular Formula | C29H30Cl2N2O2 |
| Molecular Weight | 509.48 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | 4-[4-[[3-(2,6-dichlorophenyl)-5-propan-2-yl-1,2-oxazol-4-yl]methoxy]phenyl]-2-ethenylaniline;ethane |
| SMILES | C=Cc1cc(-c2ccc(OCc3c(-c4c(Cl)cccc4Cl)noc3C(C)C)cc2)ccc1N.CC |
| InChI | InChI=1S/C27H24Cl2N2O2.C2H6/c1-4-17-14-19(10-13-24(17)30)18-8-11-20(12-9-18)32-15-21-26(31-33-27(21)16(2)3)25-22(28)6-5-7-23(25)29;1-2/h4-14,16H,1,15,30H2,2-3H3;1-2H3 |
| InChIKey | KWVOPQZYWPDKMG-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.48 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|