C25H20BCl2NO2 — CID 153394994
CID 153394994 (PubChem CID 153394994) has the molecular formula C25H20BCl2NO2 and a molecular weight of 448.16 g/mol.
| Compound Name | CID 153394994 |
|---|---|
| PubChem CID | 153394994 |
| Molecular Formula | C25H20BCl2NO2 |
| Molecular Weight | 448.16 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(-c2ccc(OCc3c(-c4c(Cl)cccc4Cl)noc3C(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H20BCl2NO2/c1-15(2)25-20(24(29-31-25)23-21(27)4-3-5-22(23)28)14-30-19-12-8-17(9-13-19)16-6-10-18(26)11-7-16/h3-13,15H,14H2,1-2H3 |
| InChIKey | ZRVNNBMFXBTRLO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.16 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|