C23H25FN2 — CID 145394506
2-[(3S,4R)-3-fluoro-1-[(4-phenylphenyl)methyl]-4-prop-1-en-2-ylpiperidin-4-yl]acetonitrile (PubChem CID 145394506) has the molecular formula C23H25FN2 and a molecular weight of 348.47 g/mol. Its IUPAC name is 2-[(3S,4R)-3-fluoro-1-[(4-phenylphenyl)methyl]-4-prop-1-en-2-ylpiperidin-4-yl]acetonitrile.
| Compound Name | 2-[(3S,4R)-3-fluoro-1-[(4-phenylphenyl)methyl]-4-prop-1-en-2-ylpiperidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 145394506 |
| Molecular Formula | C23H25FN2 |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[(3S,4R)-3-fluoro-1-[(4-phenylphenyl)methyl]-4-prop-1-en-2-ylpiperidin-4-yl]acetonitrile |
| SMILES | C=C(C)[C@]1(CC#N)CCN(Cc2ccc(-c3ccccc3)cc2)C[C@H]1F |
| InChI | InChI=1S/C23H25FN2/c1-18(2)23(12-14-25)13-15-26(17-22(23)24)16-19-8-10-21(11-9-19)20-6-4-3-5-7-20/h3-11,22H,1,12-13,15-17H2,2H3/t22-,23+/m1/s1 |
| InChIKey | KUFBRSWUHNBZDS-PKTZIBPZSA-N |
| XLogP | 5.37 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|