About but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile
but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile (PubChem CID 145395012) has the molecular formula C24H28N2
and a molecular weight of 344.50 g/mol. Its IUPAC name is but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile.
Molecular Properties
| Compound Name | but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile |
| PubChem CID | 145395012 |
| Molecular Formula | C24H28N2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile |
| SMILES | CC#CC.N#CCC1CCN(Cc2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C20H22N2.C4H6/c21-13-10-17-11-14-22(15-12-17)16-18-6-8-20(9-7-18)19-4-2-1-3-5-19;1-3-4-2/h1-9,17H,10-12,14-16H2;1-2H3 |
| InChIKey | QFLARJRMAAWUIA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile?
The IUPAC name of but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile (CID 145395012) is but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile.
What is the SMILES notation for but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile?
The canonical SMILES for but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile is CC#CC.N#CCC1CCN(Cc2ccc(-c3ccccc3)cc2)CC1.
What is the InChIKey of but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile?
The InChIKey is QFLARJRMAAWUIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2.C4H6/c21-13-10-17-11-14-22(15-12-17)16-18-6-8-20(9-7-18)19-4-2-1-3-5-19;1-3-4-2/h1-9,17H,10-12,14-16H2;1-2H3.
What are the key properties of but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile?
but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile has a molecular weight of 344.50 g/mol, XLogP of 5.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-yne;2-[1-[(4-phenylphenyl)methyl]piperidin-4-yl]acetonitrile is sourced from PubChem (CID 145395012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).