C19H27N3 — CID 145394544
3-[[[4-(cyanomethyl)cyclohexyl]amino]methyl]benzonitrile;propane (PubChem CID 145394544) has the molecular formula C19H27N3 and a molecular weight of 297.45 g/mol. Its IUPAC name is 3-[[[4-(cyanomethyl)cyclohexyl]amino]methyl]benzonitrile;propane.
| Compound Name | 3-[[[4-(cyanomethyl)cyclohexyl]amino]methyl]benzonitrile;propane |
|---|---|
| PubChem CID | 145394544 |
| Molecular Formula | C19H27N3 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.22 |
| IUPAC Name | 3-[[[4-(cyanomethyl)cyclohexyl]amino]methyl]benzonitrile;propane |
| SMILES | CCC.N#CCC1CCC(NCc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C16H19N3.C3H8/c17-9-8-13-4-6-16(7-5-13)19-12-15-3-1-2-14(10-15)11-18;1-3-2/h1-3,10,13,16,19H,4-8,12H2;3H2,1-2H3 |
| InChIKey | GIESPRJPWJNOEA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |