C15H30BNO4 — CID 145395519
ethylboronic acid;2-(piperidin-1-ylmethyl)cyclohexane-1-carboxylic acid (PubChem CID 145395519) has the molecular formula C15H30BNO4 and a molecular weight of 299.22 g/mol. Its IUPAC name is ethylboronic acid;2-(piperidin-1-ylmethyl)cyclohexane-1-carboxylic acid.
| Compound Name | ethylboronic acid;2-(piperidin-1-ylmethyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 145395519 |
| Molecular Formula | C15H30BNO4 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | ethylboronic acid;2-(piperidin-1-ylmethyl)cyclohexane-1-carboxylic acid |
| SMILES | CCB(O)O.O=C(O)C1CCCCC1CN1CCCCC1 |
| InChI | InChI=1S/C13H23NO2.C2H7BO2/c15-13(16)12-7-3-2-6-11(12)10-14-8-4-1-5-9-14;1-2-3(4)5/h11-12H,1-10H2,(H,15,16);4-5H,2H2,1H3 |
| InChIKey | AOKWMOBVMRNFEA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|