C30H42N2O2 — CID 145395788
(E)-3,4-dimethyl-2-(methyliminomethyl)-N-[3-(1-phenylbutoxymethyl)phenyl]-N-propylhex-2-enamide (PubChem CID 145395788) has the molecular formula C30H42N2O2 and a molecular weight of 462.68 g/mol. Its IUPAC name is (E)-3,4-dimethyl-2-(methyliminomethyl)-N-[3-(1-phenylbutoxymethyl)phenyl]-N-propylhex-2-enamide.
| Compound Name | (E)-3,4-dimethyl-2-(methyliminomethyl)-N-[3-(1-phenylbutoxymethyl)phenyl]-N-propylhex-2-enamide |
|---|---|
| PubChem CID | 145395788 |
| Molecular Formula | C30H42N2O2 |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.32 |
| IUPAC Name | (E)-3,4-dimethyl-2-(methyliminomethyl)-N-[3-(1-phenylbutoxymethyl)phenyl]-N-propylhex-2-enamide |
| SMILES | CCCC(OCc1cccc(N(CCC)C(=O)C(/C=N/C)=C(\C)C(C)CC)c1)c1ccccc1 |
| InChI | InChI=1S/C30H42N2O2/c1-7-14-29(26-16-11-10-12-17-26)34-22-25-15-13-18-27(20-25)32(19-8-2)30(33)28(21-31-6)24(5)23(4)9-3/h10-13,15-18,20-21,23,29H,7-9,14,19,22H2,1-6H3/b28-24+,31-21+ |
| InChIKey | NZCAUIMBACJSSX-XHHMPNEUSA-N |
| XLogP | 7.55 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|