C25H35N2O4+ — CID 88785490
carboxy-(3,4-dimethylphenyl)-methyl-[(3-pentan-2-ylphenyl)-propylcarbamoyl]oxyazanium (PubChem CID 88785490) has the molecular formula C25H35N2O4+ and a molecular weight of 427.57 g/mol. Its IUPAC name is carboxy-(3,4-dimethylphenyl)-methyl-[(3-pentan-2-ylphenyl)-propylcarbamoyl]oxyazanium.
| Compound Name | carboxy-(3,4-dimethylphenyl)-methyl-[(3-pentan-2-ylphenyl)-propylcarbamoyl]oxyazanium |
|---|---|
| PubChem CID | 88785490 |
| Molecular Formula | C25H35N2O4+ |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | carboxy-(3,4-dimethylphenyl)-methyl-[(3-pentan-2-ylphenyl)-propylcarbamoyl]oxyazanium |
| SMILES | CCCC(C)c1cccc(N(CCC)C(=O)O[N+](C)(C(=O)O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C25H34N2O4/c1-7-10-19(4)21-11-9-12-22(17-21)26(15-8-2)24(28)31-27(6,25(29)30)23-14-13-18(3)20(5)16-23/h9,11-14,16-17,19H,7-8,10,15H2,1-6H3/p+1 |
| InChIKey | SRUUFAGHMXLRIY-UHFFFAOYSA-O |
| XLogP | 6.79 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|