C24H34N2O4 — CID 158487142
methyl-(3-pentan-2-ylphenyl)carbamic acid;methyl-(2-propan-2-ylphenyl)carbamic acid (PubChem CID 158487142) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is methyl-(3-pentan-2-ylphenyl)carbamic acid;methyl-(2-propan-2-ylphenyl)carbamic acid.
| Compound Name | methyl-(3-pentan-2-ylphenyl)carbamic acid;methyl-(2-propan-2-ylphenyl)carbamic acid |
|---|---|
| PubChem CID | 158487142 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | methyl-(3-pentan-2-ylphenyl)carbamic acid;methyl-(2-propan-2-ylphenyl)carbamic acid |
| SMILES | CC(C)c1ccccc1N(C)C(=O)O.CCCC(C)c1cccc(N(C)C(=O)O)c1 |
| InChI | InChI=1S/C13H19NO2.C11H15NO2/c1-4-6-10(2)11-7-5-8-12(9-11)14(3)13(15)16;1-8(2)9-6-4-5-7-10(9)12(3)11(13)14/h5,7-10H,4,6H2,1-3H3,(H,15,16);4-8H,1-3H3,(H,13,14) |
| InChIKey | HIFUZWHABXKGPZ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |