C13H30N4O2 — CID 145399713
N,N-dimethylmethanamine;N-(3-hydroxypropyl)-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 145399713) has the molecular formula C13H30N4O2 and a molecular weight of 274.41 g/mol. Its IUPAC name is N,N-dimethylmethanamine;N-(3-hydroxypropyl)-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N,N-dimethylmethanamine;N-(3-hydroxypropyl)-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 145399713 |
| Molecular Formula | C13H30N4O2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N,N-dimethylmethanamine;N-(3-hydroxypropyl)-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CN(C)C.CN1CCN(CC(=O)NCCCO)CC1 |
| InChI | InChI=1S/C10H21N3O2.C3H9N/c1-12-4-6-13(7-5-12)9-10(15)11-3-2-8-14;1-4(2)3/h14H,2-9H2,1H3,(H,11,15);1-3H3 |
| InChIKey | OAVFEGJJUHTOMI-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|