C9H17F2N3O2 — CID 106176935
N-(2,2-difluoro-3-hydroxypropyl)-2-piperazin-1-ylacetamide (PubChem CID 106176935) has the molecular formula C9H17F2N3O2 and a molecular weight of 237.25 g/mol. Its IUPAC name is N-(2,2-difluoro-3-hydroxypropyl)-2-piperazin-1-ylacetamide.
| Compound Name | N-(2,2-difluoro-3-hydroxypropyl)-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 106176935 |
| Molecular Formula | C9H17F2N3O2 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-(2,2-difluoro-3-hydroxypropyl)-2-piperazin-1-ylacetamide |
| SMILES | O=C(CN1CCNCC1)NCC(F)(F)CO |
| InChI | InChI=1S/C9H17F2N3O2/c10-9(11,7-15)6-13-8(16)5-14-3-1-12-2-4-14/h12,15H,1-7H2,(H,13,16) |
| InChIKey | AVUJVHHNANQJEU-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |