C21H31BN2O6 — CID 145400085
3-morpholin-4-ylpropyl (2S)-2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-methylbutanoate (PubChem CID 145400085) has the molecular formula C21H31BN2O6 and a molecular weight of 418.30 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl (2S)-2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-methylbutanoate.
| Compound Name | 3-morpholin-4-ylpropyl (2S)-2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 145400085 |
| Molecular Formula | C21H31BN2O6 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 3-morpholin-4-ylpropyl (2S)-2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-methylbutanoate |
| SMILES | Cc1c(C(=O)N[C@H](C(=O)OCCCN2CCOCC2)C(C)C)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C21H31BN2O6/c1-14(2)19(21(26)29-10-4-7-24-8-11-28-12-9-24)23-20(25)17-6-5-16-13-30-22(27)18(16)15(17)3/h5-6,14,19,27H,4,7-13H2,1-3H3,(H,23,25)/t19-/m0/s1 |
| InChIKey | GESBDAPUAIMGTR-IBGZPJMESA-N |
| XLogP | 0.23 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|