C20H29NO3 — CID 145402428
ethane;methyl 4-(benzylcarbamoyl)bicyclo[2.2.2]octane-1-carboxylate (PubChem CID 145402428) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is ethane;methyl 4-(benzylcarbamoyl)bicyclo[2.2.2]octane-1-carboxylate.
| Compound Name | ethane;methyl 4-(benzylcarbamoyl)bicyclo[2.2.2]octane-1-carboxylate |
|---|---|
| PubChem CID | 145402428 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | ethane;methyl 4-(benzylcarbamoyl)bicyclo[2.2.2]octane-1-carboxylate |
| SMILES | CC.COC(=O)C12CCC(C(=O)NCc3ccccc3)(CC1)CC2 |
| InChI | InChI=1S/C18H23NO3.C2H6/c1-22-16(21)18-10-7-17(8-11-18,9-12-18)15(20)19-13-14-5-3-2-4-6-14;1-2/h2-6H,7-13H2,1H3,(H,19,20);1-2H3 |
| InChIKey | ISTTUHNAOGENDG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |