C24H40N2O3 — CID 145402922
[2,2-dimethyl-4-(1-methylpiperidin-4-yl)oxan-4-yl]-pyridin-2-ylmethanone;1-ethoxypropane (PubChem CID 145402922) has the molecular formula C24H40N2O3 and a molecular weight of 404.60 g/mol. Its IUPAC name is [2,2-dimethyl-4-(1-methylpiperidin-4-yl)oxan-4-yl]-pyridin-2-ylmethanone;1-ethoxypropane.
| Compound Name | [2,2-dimethyl-4-(1-methylpiperidin-4-yl)oxan-4-yl]-pyridin-2-ylmethanone;1-ethoxypropane |
|---|---|
| PubChem CID | 145402922 |
| Molecular Formula | C24H40N2O3 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | [2,2-dimethyl-4-(1-methylpiperidin-4-yl)oxan-4-yl]-pyridin-2-ylmethanone;1-ethoxypropane |
| SMILES | CCCOCC.CN1CCC(C2(C(=O)c3ccccn3)CCOC(C)(C)C2)CC1 |
| InChI | InChI=1S/C19H28N2O2.C5H12O/c1-18(2)14-19(9-13-23-18,15-7-11-21(3)12-8-15)17(22)16-6-4-5-10-20-16;1-3-5-6-4-2/h4-6,10,15H,7-9,11-14H2,1-3H3;3-5H2,1-2H3 |
| InChIKey | QYFGGZHYMSMMSB-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|