C16H31NO3 — CID 145404622
6,6-dimethyloctyl 2-(2-methylprop-2-enoylamino)acetate;molecular hydrogen (PubChem CID 145404622) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is 6,6-dimethyloctyl 2-(2-methylprop-2-enoylamino)acetate;molecular hydrogen.
| Compound Name | 6,6-dimethyloctyl 2-(2-methylprop-2-enoylamino)acetate;molecular hydrogen |
|---|---|
| PubChem CID | 145404622 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | 6,6-dimethyloctyl 2-(2-methylprop-2-enoylamino)acetate;molecular hydrogen |
| SMILES | C=C(C)C(=O)NCC(=O)OCCCCCC(C)(C)CC.[H][H] |
| InChI | InChI=1S/C16H29NO3.H2/c1-6-16(4,5)10-8-7-9-11-20-14(18)12-17-15(19)13(2)3;/h2,6-12H2,1,3-5H3,(H,17,19);1H |
| InChIKey | PRFXJTCMNLJDMJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|