C19H27N3O5 — CID 145404679
2-[4-[3-(acetamidomethyl)benzoyl]piperazin-1-yl]ethyl 2-methoxyacetate (PubChem CID 145404679) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is 2-[4-[3-(acetamidomethyl)benzoyl]piperazin-1-yl]ethyl 2-methoxyacetate.
| Compound Name | 2-[4-[3-(acetamidomethyl)benzoyl]piperazin-1-yl]ethyl 2-methoxyacetate |
|---|---|
| PubChem CID | 145404679 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 2-[4-[3-(acetamidomethyl)benzoyl]piperazin-1-yl]ethyl 2-methoxyacetate |
| SMILES | COCC(=O)OCCN1CCN(C(=O)c2cccc(CNC(C)=O)c2)CC1 |
| InChI | InChI=1S/C19H27N3O5/c1-15(23)20-13-16-4-3-5-17(12-16)19(25)22-8-6-21(7-9-22)10-11-27-18(24)14-26-2/h3-5,12H,6-11,13-14H2,1-2H3,(H,20,23) |
| InChIKey | LCQFFGIVQJXBTC-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |