C24H49N3 — CID 145405640
N-methyl-1-[2-(8-methyldec-9-enyl)-2-(8-methylnonyl)hydrazinyl]ethenamine (PubChem CID 145405640) has the molecular formula C24H49N3 and a molecular weight of 379.68 g/mol. Its IUPAC name is N-methyl-1-[2-(8-methyldec-9-enyl)-2-(8-methylnonyl)hydrazinyl]ethenamine.
| Compound Name | N-methyl-1-[2-(8-methyldec-9-enyl)-2-(8-methylnonyl)hydrazinyl]ethenamine |
|---|---|
| PubChem CID | 145405640 |
| Molecular Formula | C24H49N3 |
| Molecular Weight | 379.68 g/mol |
| Exact Mass | 379.39 |
| IUPAC Name | N-methyl-1-[2-(8-methyldec-9-enyl)-2-(8-methylnonyl)hydrazinyl]ethenamine |
| SMILES | C=CC(C)CCCCCCCN(CCCCCCCC(C)C)NC(=C)NC |
| InChI | InChI=1S/C24H49N3/c1-7-23(4)19-15-11-9-13-17-21-27(26-24(5)25-6)20-16-12-8-10-14-18-22(2)3/h7,22-23,25-26H,1,5,8-21H2,2-4,6H3 |
| InChIKey | LLCLMLAMYNRCCU-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.68 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|