C30H60N2 — CID 167511061
2-methyl-1-nonyl-1-(3-octyldodeca-1,11-dien-2-yl)hydrazine (PubChem CID 167511061) has the molecular formula C30H60N2 and a molecular weight of 448.82 g/mol. Its IUPAC name is 2-methyl-1-nonyl-1-(3-octyldodeca-1,11-dien-2-yl)hydrazine.
| Compound Name | 2-methyl-1-nonyl-1-(3-octyldodeca-1,11-dien-2-yl)hydrazine |
|---|---|
| PubChem CID | 167511061 |
| Molecular Formula | C30H60N2 |
| Molecular Weight | 448.82 g/mol |
| Exact Mass | 448.48 |
| IUPAC Name | 2-methyl-1-nonyl-1-(3-octyldodeca-1,11-dien-2-yl)hydrazine |
| SMILES | C=CCCCCCCCC(CCCCCCCC)C(=C)N(CCCCCCCCC)NC |
| InChI | InChI=1S/C30H60N2/c1-6-9-12-15-18-21-24-27-30(26-23-20-17-14-11-8-3)29(4)32(31-5)28-25-22-19-16-13-10-7-2/h6,30-31H,1,4,7-28H2,2-3,5H3 |
| InChIKey | WCHJGACRZOKPQX-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.82 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|