C18H35N3 — CID 142205316
1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane;ethenamine (PubChem CID 142205316) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane;ethenamine.
| Compound Name | 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane;ethenamine |
|---|---|
| PubChem CID | 142205316 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | 1-[(3R)-4,5-dimethyl-3-(2-methylpropyl)hexa-1,5-dien-2-yl]diazinane;ethenamine |
| SMILES | C=C(C)C(C)[C@@H](CC(C)C)C(=C)N1CCCCN1.C=CN |
| InChI | InChI=1S/C16H30N2.C2H5N/c1-12(2)11-16(14(5)13(3)4)15(6)18-10-8-7-9-17-18;1-2-3/h12,14,16-17H,3,6-11H2,1-2,4-5H3;2H,1,3H2/t14?,16-;/m1./s1 |
| InChIKey | FSKGERKPEAHRPL-BXWZNKKMSA-N |
| XLogP | 4.06 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|