C23H18N10O3 — CID 145405834
N-[4-[5-(3H-benzimidazol-5-yl)-1,3,4-oxadiazol-2-yl]-2-[(9-ethyl-6-oxo-1H-purin-2-yl)amino]phenyl]formamide (PubChem CID 145405834) has the molecular formula C23H18N10O3 and a molecular weight of 482.46 g/mol. Its IUPAC name is N-[4-[5-(3H-benzimidazol-5-yl)-1,3,4-oxadiazol-2-yl]-2-[(9-ethyl-6-oxo-1H-purin-2-yl)amino]phenyl]formamide.
| Compound Name | N-[4-[5-(3H-benzimidazol-5-yl)-1,3,4-oxadiazol-2-yl]-2-[(9-ethyl-6-oxo-1H-purin-2-yl)amino]phenyl]formamide |
|---|---|
| PubChem CID | 145405834 |
| Molecular Formula | C23H18N10O3 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | N-[4-[5-(3H-benzimidazol-5-yl)-1,3,4-oxadiazol-2-yl]-2-[(9-ethyl-6-oxo-1H-purin-2-yl)amino]phenyl]formamide |
| SMILES | CCn1cnc2c(=O)[nH]c(Nc3cc(-c4nnc(-c5ccc6nc[nH]c6c5)o4)ccc3NC=O)nc21 |
| InChI | InChI=1S/C23H18N10O3/c1-2-33-10-26-18-19(33)29-23(30-20(18)35)28-17-8-13(4-6-15(17)27-11-34)22-32-31-21(36-22)12-3-5-14-16(7-12)25-9-24-14/h3-11H,2H2,1H3,(H,24,25)(H,27,34)(H2,28,29,30,35) |
| InChIKey | GYWGMAXNSNXYBF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 172.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|