C24H21N11O2 — CID 145405843
N-[2-[(6-amino-9-propan-2-ylpurin-2-yl)amino]-4-[5-(3H-benzimidazol-5-yl)-1,3,4-oxadiazol-2-yl]phenyl]formamide (PubChem CID 145405843) has the molecular formula C24H21N11O2 and a molecular weight of 495.51 g/mol. Its IUPAC name is N-[2-[(6-amino-9-propan-2-ylpurin-2-yl)amino]-4-[5-(3H-benzimidazol-5-yl)-1,3,4-oxadiazol-2-yl]phenyl]formamide.
| Compound Name | N-[2-[(6-amino-9-propan-2-ylpurin-2-yl)amino]-4-[5-(3H-benzimidazol-5-yl)-1,3,4-oxadiazol-2-yl]phenyl]formamide |
|---|---|
| PubChem CID | 145405843 |
| Molecular Formula | C24H21N11O2 |
| Molecular Weight | 495.51 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | N-[2-[(6-amino-9-propan-2-ylpurin-2-yl)amino]-4-[5-(3H-benzimidazol-5-yl)-1,3,4-oxadiazol-2-yl]phenyl]formamide |
| SMILES | CC(C)n1cnc2c(N)nc(Nc3cc(-c4nnc(-c5ccc6nc[nH]c6c5)o4)ccc3NC=O)nc21 |
| InChI | InChI=1S/C24H21N11O2/c1-12(2)35-10-28-19-20(25)31-24(32-21(19)35)30-18-8-14(4-6-16(18)29-11-36)23-34-33-22(37-23)13-3-5-15-17(7-13)27-9-26-15/h3-12H,1-2H3,(H,26,27)(H,29,36)(H3,25,30,31,32) |
| InChIKey | RMBFAQKJISRQMA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 178.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|