C22H21Cl2N3OS2 — CID 145406417
N-[4-[[6-amino-2-(4-chlorophenyl)cyclohex-2-en-1-yl]methoxy]-3-chlorophenyl]sulfanyl-1,3-thiazol-4-amine (PubChem CID 145406417) has the molecular formula C22H21Cl2N3OS2 and a molecular weight of 478.47 g/mol. Its IUPAC name is N-[4-[[6-amino-2-(4-chlorophenyl)cyclohex-2-en-1-yl]methoxy]-3-chlorophenyl]sulfanyl-1,3-thiazol-4-amine.
| Compound Name | N-[4-[[6-amino-2-(4-chlorophenyl)cyclohex-2-en-1-yl]methoxy]-3-chlorophenyl]sulfanyl-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 145406417 |
| Molecular Formula | C22H21Cl2N3OS2 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | N-[4-[[6-amino-2-(4-chlorophenyl)cyclohex-2-en-1-yl]methoxy]-3-chlorophenyl]sulfanyl-1,3-thiazol-4-amine |
| SMILES | NC1CCC=C(c2ccc(Cl)cc2)C1COc1ccc(SNc2cscn2)cc1Cl |
| InChI | InChI=1S/C22H21Cl2N3OS2/c23-15-6-4-14(5-7-15)17-2-1-3-20(25)18(17)11-28-21-9-8-16(10-19(21)24)30-27-22-12-29-13-26-22/h2,4-10,12-13,18,20,27H,1,3,11,25H2 |
| InChIKey | OOOVVMJGZPPWQI-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|