C24H36N2O — CID 145408547
ethane;2-[[1-(2-methyl-3-phenylphenyl)piperidin-4-yl]amino]butan-1-ol (PubChem CID 145408547) has the molecular formula C24H36N2O and a molecular weight of 368.57 g/mol. Its IUPAC name is ethane;2-[[1-(2-methyl-3-phenylphenyl)piperidin-4-yl]amino]butan-1-ol.
| Compound Name | ethane;2-[[1-(2-methyl-3-phenylphenyl)piperidin-4-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 145408547 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | ethane;2-[[1-(2-methyl-3-phenylphenyl)piperidin-4-yl]amino]butan-1-ol |
| SMILES | CC.CCC(CO)NC1CCN(c2cccc(-c3ccccc3)c2C)CC1 |
| InChI | InChI=1S/C22H30N2O.C2H6/c1-3-19(16-25)23-20-12-14-24(15-13-20)22-11-7-10-21(17(22)2)18-8-5-4-6-9-18;1-2/h4-11,19-20,23,25H,3,12-16H2,1-2H3;1-2H3 |
| InChIKey | VZMNDSYYKPJWRS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |