C21H36N2O — CID 56859983
6-[[1-(2,3-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol (PubChem CID 56859983) has the molecular formula C21H36N2O and a molecular weight of 332.53 g/mol. Its IUPAC name is 6-[[1-(2,3-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol.
| Compound Name | 6-[[1-(2,3-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 56859983 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | 6-[[1-(2,3-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol |
| SMILES | Cc1cccc(N2CCC(NC(C)CCCC(C)(C)O)CC2)c1C |
| InChI | InChI=1S/C21H36N2O/c1-16-8-6-10-20(18(16)3)23-14-11-19(12-15-23)22-17(2)9-7-13-21(4,5)24/h6,8,10,17,19,22,24H,7,9,11-15H2,1-5H3 |
| InChIKey | MKNMLRUTIALSAR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |