C22H38N2O — CID 56859608
2,6-dimethyl-8-[[1-(3-methylphenyl)piperidin-4-yl]amino]octan-2-ol (PubChem CID 56859608) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is 2,6-dimethyl-8-[[1-(3-methylphenyl)piperidin-4-yl]amino]octan-2-ol.
| Compound Name | 2,6-dimethyl-8-[[1-(3-methylphenyl)piperidin-4-yl]amino]octan-2-ol |
|---|---|
| PubChem CID | 56859608 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | 2,6-dimethyl-8-[[1-(3-methylphenyl)piperidin-4-yl]amino]octan-2-ol |
| SMILES | Cc1cccc(N2CCC(NCCC(C)CCCC(C)(C)O)CC2)c1 |
| InChI | InChI=1S/C22H38N2O/c1-18(8-6-13-22(3,4)25)10-14-23-20-11-15-24(16-12-20)21-9-5-7-19(2)17-21/h5,7,9,17-18,20,23,25H,6,8,10-16H2,1-4H3 |
| InChIKey | PPNRPQLOIYFVGZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |