C20H30N4 — CID 131924607
N-[(2-butyl-1H-imidazol-5-yl)methyl]-1-(3-methylphenyl)piperidin-4-amine (PubChem CID 131924607) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is N-[(2-butyl-1H-imidazol-5-yl)methyl]-1-(3-methylphenyl)piperidin-4-amine.
| Compound Name | N-[(2-butyl-1H-imidazol-5-yl)methyl]-1-(3-methylphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 131924607 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | N-[(2-butyl-1H-imidazol-5-yl)methyl]-1-(3-methylphenyl)piperidin-4-amine |
| SMILES | CCCCc1ncc(CNC2CCN(c3cccc(C)c3)CC2)[nH]1 |
| InChI | InChI=1S/C20H30N4/c1-3-4-8-20-22-15-18(23-20)14-21-17-9-11-24(12-10-17)19-7-5-6-16(2)13-19/h5-7,13,15,17,21H,3-4,8-12,14H2,1-2H3,(H,22,23) |
| InChIKey | UZBGQYHBYFDWEJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |