C20H28N4O2 — CID 154912859
N-[(2-ethylpyrimidin-5-yl)methyl]-1-(3-methylphenyl)piperidin-4-amine;formic acid (PubChem CID 154912859) has the molecular formula C20H28N4O2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(2-ethylpyrimidin-5-yl)methyl]-1-(3-methylphenyl)piperidin-4-amine;formic acid.
| Compound Name | N-[(2-ethylpyrimidin-5-yl)methyl]-1-(3-methylphenyl)piperidin-4-amine;formic acid |
|---|---|
| PubChem CID | 154912859 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | N-[(2-ethylpyrimidin-5-yl)methyl]-1-(3-methylphenyl)piperidin-4-amine;formic acid |
| SMILES | CCc1ncc(CNC2CCN(c3cccc(C)c3)CC2)cn1.O=CO |
| InChI | InChI=1S/C19H26N4.CH2O2/c1-3-19-21-13-16(14-22-19)12-20-17-7-9-23(10-8-17)18-6-4-5-15(2)11-18;2-1-3/h4-6,11,13-14,17,20H,3,7-10,12H2,1-2H3;1H,(H,2,3) |
| InChIKey | SSVQQTKIFHVNCI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|