C22H31N3S — CID 131909862
1-(3-methylphenyl)-N-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-amine (PubChem CID 131909862) has the molecular formula C22H31N3S and a molecular weight of 369.58 g/mol. Its IUPAC name is 1-(3-methylphenyl)-N-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-amine.
| Compound Name | 1-(3-methylphenyl)-N-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 131909862 |
| Molecular Formula | C22H31N3S |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 1-(3-methylphenyl)-N-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-amine |
| SMILES | Cc1cccc(N2CCC(NCc3cc(CN4CCCC4)cs3)CC2)c1 |
| InChI | InChI=1S/C22H31N3S/c1-18-5-4-6-21(13-18)25-11-7-20(8-12-25)23-15-22-14-19(17-26-22)16-24-9-2-3-10-24/h4-6,13-14,17,20,23H,2-3,7-12,15-16H2,1H3 |
| InChIKey | HCXVFLOTAVQUHD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |