C21H35N3S — CID 56901814
1-methyl-4-[1-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-yl]piperidine (PubChem CID 56901814) has the molecular formula C21H35N3S and a molecular weight of 361.60 g/mol. Its IUPAC name is 1-methyl-4-[1-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-yl]piperidine.
| Compound Name | 1-methyl-4-[1-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-yl]piperidine |
|---|---|
| PubChem CID | 56901814 |
| Molecular Formula | C21H35N3S |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | 1-methyl-4-[1-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]piperidin-4-yl]piperidine |
| SMILES | CN1CCC(C2CCN(Cc3cc(CN4CCCC4)cs3)CC2)CC1 |
| InChI | InChI=1S/C21H35N3S/c1-22-10-4-19(5-11-22)20-6-12-24(13-7-20)16-21-14-18(17-25-21)15-23-8-2-3-9-23/h14,17,19-20H,2-13,15-16H2,1H3 |
| InChIKey | UPUYYEZANFWOQF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |