C19H26N2O4S2 — CID 154908867
formic acid;5-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 154908867) has the molecular formula C19H26N2O4S2 and a molecular weight of 410.56 g/mol. Its IUPAC name is formic acid;5-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | formic acid;5-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 154908867 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | formic acid;5-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | O=CO.O=CO.c1cc2c(s1)CCN(Cc1cc(CN3CCCC3)cs1)C2 |
| InChI | InChI=1S/C17H22N2S2.2CH2O2/c1-2-6-18(5-1)10-14-9-16(21-13-14)12-19-7-3-17-15(11-19)4-8-20-17;2*2-1-3/h4,8-9,13H,1-3,5-7,10-12H2;2*1H,(H,2,3) |
| InChIKey | DIBGAFNIVSETEJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|