C19H30N6O2S — CID 154912941
formic acid;1-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-4-(1H-1,2,4-triazol-5-ylmethyl)piperazine (PubChem CID 154912941) has the molecular formula C19H30N6O2S and a molecular weight of 406.56 g/mol. Its IUPAC name is formic acid;1-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-4-(1H-1,2,4-triazol-5-ylmethyl)piperazine.
| Compound Name | formic acid;1-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-4-(1H-1,2,4-triazol-5-ylmethyl)piperazine |
|---|---|
| PubChem CID | 154912941 |
| Molecular Formula | C19H30N6O2S |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | formic acid;1-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-4-(1H-1,2,4-triazol-5-ylmethyl)piperazine |
| SMILES | O=CO.c1n[nH]c(CN2CCN(Cc3cc(CN4CCCCC4)cs3)CC2)n1 |
| InChI | InChI=1S/C18H28N6S.CH2O2/c1-2-4-22(5-3-1)11-16-10-17(25-14-16)12-23-6-8-24(9-7-23)13-18-19-15-20-21-18;2-1-3/h10,14-15H,1-9,11-13H2,(H,19,20,21);1H,(H,2,3) |
| InChIKey | RSIRGEJANDUFPF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|