C16H24N2O3S — CID 91840101
(3R)-4-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]morpholine-3-carboxylic acid (PubChem CID 91840101) has the molecular formula C16H24N2O3S and a molecular weight of 324.45 g/mol. Its IUPAC name is (3R)-4-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]morpholine-3-carboxylic acid.
| Compound Name | (3R)-4-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]morpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 91840101 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (3R)-4-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]morpholine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1COCCN1Cc1cc(CN2CCCCC2)cs1 |
| InChI | InChI=1S/C16H24N2O3S/c19-16(20)15-11-21-7-6-18(15)10-14-8-13(12-22-14)9-17-4-2-1-3-5-17/h8,12,15H,1-7,9-11H2,(H,19,20)/t15-/m1/s1 |
| InChIKey | KRCGGWIIJTWXBW-OAHLLOKOSA-N |
| XLogP | 2.02 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |