C18H28N4OS — CID 50979334
2-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one (PubChem CID 50979334) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is 2-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one.
| Compound Name | 2-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 50979334 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
| SMILES | O=C1NCCN2CCN(Cc3cc(CN4CCCCC4)cs3)CC12 |
| InChI | InChI=1S/C18H28N4OS/c23-18-17-13-21(8-9-22(17)7-4-19-18)12-16-10-15(14-24-16)11-20-5-2-1-3-6-20/h10,14,17H,1-9,11-13H2,(H,19,23) |
| InChIKey | CHLACUONARUMLN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |