C22H31N3S — CID 124752129
(2R)-1-methyl-2-phenyl-4-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]piperazine (PubChem CID 124752129) has the molecular formula C22H31N3S and a molecular weight of 369.58 g/mol. Its IUPAC name is (2R)-1-methyl-2-phenyl-4-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]piperazine.
| Compound Name | (2R)-1-methyl-2-phenyl-4-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]piperazine |
|---|---|
| PubChem CID | 124752129 |
| Molecular Formula | C22H31N3S |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | (2R)-1-methyl-2-phenyl-4-[[4-(piperidin-1-ylmethyl)thiophen-2-yl]methyl]piperazine |
| SMILES | CN1CCN(Cc2cc(CN3CCCCC3)cs2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H31N3S/c1-23-12-13-25(17-22(23)20-8-4-2-5-9-20)16-21-14-19(18-26-21)15-24-10-6-3-7-11-24/h2,4-5,8-9,14,18,22H,3,6-7,10-13,15-17H2,1H3/t22-/m0/s1 |
| InChIKey | IMFKZPTWPYEMSD-QFIPXVFZSA-N |
| XLogP | 4.22 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |