C19H29N3O3 — CID 171688367
formic acid;2-(4-methyl-3-phenylpiperazin-1-yl)-1-piperidin-1-ylethanone (PubChem CID 171688367) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is formic acid;2-(4-methyl-3-phenylpiperazin-1-yl)-1-piperidin-1-ylethanone.
| Compound Name | formic acid;2-(4-methyl-3-phenylpiperazin-1-yl)-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 171688367 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | formic acid;2-(4-methyl-3-phenylpiperazin-1-yl)-1-piperidin-1-ylethanone |
| SMILES | CN1CCN(CC(=O)N2CCCCC2)CC1c1ccccc1.O=CO |
| InChI | InChI=1S/C18H27N3O.CH2O2/c1-19-12-13-20(14-17(19)16-8-4-2-5-9-16)15-18(22)21-10-6-3-7-11-21;2-1-3/h2,4-5,8-9,17H,3,6-7,10-15H2,1H3;1H,(H,2,3) |
| InChIKey | FQWCJMASXMILJN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|