C20H25FN2OS — CID 135091119
2-(4-fluorophenyl)-4-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]morpholine (PubChem CID 135091119) has the molecular formula C20H25FN2OS and a molecular weight of 360.50 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]morpholine.
| Compound Name | 2-(4-fluorophenyl)-4-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]morpholine |
|---|---|
| PubChem CID | 135091119 |
| Molecular Formula | C20H25FN2OS |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[[4-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methyl]morpholine |
| SMILES | Fc1ccc(C2CN(Cc3cc(CN4CCCC4)cs3)CCO2)cc1 |
| InChI | InChI=1S/C20H25FN2OS/c21-18-5-3-17(4-6-18)20-14-23(9-10-24-20)13-19-11-16(15-25-19)12-22-7-1-2-8-22/h3-6,11,15,20H,1-2,7-10,12-14H2 |
| InChIKey | AWSXHAHPKHQYNE-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |