C22H26N4 — CID 124757280
(2R)-1-methyl-2-phenyl-4-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]piperazine (PubChem CID 124757280) has the molecular formula C22H26N4 and a molecular weight of 346.48 g/mol. Its IUPAC name is (2R)-1-methyl-2-phenyl-4-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]piperazine.
| Compound Name | (2R)-1-methyl-2-phenyl-4-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 124757280 |
| Molecular Formula | C22H26N4 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (2R)-1-methyl-2-phenyl-4-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]piperazine |
| SMILES | CN1CCN(Cc2ccccc2Cn2cccn2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C22H26N4/c1-24-14-15-25(18-22(24)19-8-3-2-4-9-19)16-20-10-5-6-11-21(20)17-26-13-7-12-23-26/h2-13,22H,14-18H2,1H3/t22-/m0/s1 |
| InChIKey | WAOSAJVSVHZXDN-QFIPXVFZSA-N |
| XLogP | 3.42 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |