C15H22Cl2N4 — CID 154906169
1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]pyrrolidin-3-amine;dihydrochloride (PubChem CID 154906169) has the molecular formula C15H22Cl2N4 and a molecular weight of 329.27 g/mol. Its IUPAC name is 1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]pyrrolidin-3-amine;dihydrochloride.
| Compound Name | 1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]pyrrolidin-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 154906169 |
| Molecular Formula | C15H22Cl2N4 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]pyrrolidin-3-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(Cc2ccccc2Cn2cccn2)C1 |
| InChI | InChI=1S/C15H20N4.2ClH/c16-15-6-9-18(12-15)10-13-4-1-2-5-14(13)11-19-8-3-7-17-19;;/h1-5,7-8,15H,6,9-12,16H2;2*1H |
| InChIKey | BWCAIVLJDSIJLU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |