C14H15IN2S — CID 112750992
3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-5-iodoaniline (PubChem CID 112750992) has the molecular formula C14H15IN2S and a molecular weight of 370.26 g/mol. Its IUPAC name is 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-5-iodoaniline.
| Compound Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-5-iodoaniline |
|---|---|
| PubChem CID | 112750992 |
| Molecular Formula | C14H15IN2S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-5-iodoaniline |
| SMILES | Nc1cc(I)cc(CN2CCc3sccc3C2)c1 |
| InChI | InChI=1S/C14H15IN2S/c15-12-5-10(6-13(16)7-12)8-17-3-1-14-11(9-17)2-4-18-14/h2,4-7H,1,3,8-9,16H2 |
| InChIKey | WORNQZKVAURDTJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|