C29H41N7O3 — CID 145409679
4-cyclohexyloxy-N-[1-(oxan-4-yl)pyrazol-4-yl]-5-[(2E)-penta-2,4-dien-2-yl]pyrrolo[3,2-d]pyrimidin-2-amine;morpholine (PubChem CID 145409679) has the molecular formula C29H41N7O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is 4-cyclohexyloxy-N-[1-(oxan-4-yl)pyrazol-4-yl]-5-[(2E)-penta-2,4-dien-2-yl]pyrrolo[3,2-d]pyrimidin-2-amine;morpholine.
| Compound Name | 4-cyclohexyloxy-N-[1-(oxan-4-yl)pyrazol-4-yl]-5-[(2E)-penta-2,4-dien-2-yl]pyrrolo[3,2-d]pyrimidin-2-amine;morpholine |
|---|---|
| PubChem CID | 145409679 |
| Molecular Formula | C29H41N7O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | 4-cyclohexyloxy-N-[1-(oxan-4-yl)pyrazol-4-yl]-5-[(2E)-penta-2,4-dien-2-yl]pyrrolo[3,2-d]pyrimidin-2-amine;morpholine |
| SMILES | C1COCCN1.C=C/C=C(\C)n1ccc2nc(Nc3cnn(C4CCOCC4)c3)nc(OC3CCCCC3)c21 |
| InChI | InChI=1S/C25H32N6O2.C4H9NO/c1-3-7-18(2)30-13-10-22-23(30)24(33-21-8-5-4-6-9-21)29-25(28-22)27-19-16-26-31(17-19)20-11-14-32-15-12-20;1-3-6-4-2-5-1/h3,7,10,13,16-17,20-21H,1,4-6,8-9,11-12,14-15H2,2H3,(H,27,28,29);5H,1-4H2/b18-7+; |
| InChIKey | XANIVCJWHFSSQS-CWSPIBBISA-N |
| XLogP | 5.09 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|