C19H23FN2OS — CID 145410010
2-[2-[(dimethylamino)methyl]-4-[(Z)-4-fluorobut-2-enoxy]phenyl]sulfanylaniline (PubChem CID 145410010) has the molecular formula C19H23FN2OS and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-[2-[(dimethylamino)methyl]-4-[(Z)-4-fluorobut-2-enoxy]phenyl]sulfanylaniline.
| Compound Name | 2-[2-[(dimethylamino)methyl]-4-[(Z)-4-fluorobut-2-enoxy]phenyl]sulfanylaniline |
|---|---|
| PubChem CID | 145410010 |
| Molecular Formula | C19H23FN2OS |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-[2-[(dimethylamino)methyl]-4-[(Z)-4-fluorobut-2-enoxy]phenyl]sulfanylaniline |
| SMILES | CN(C)Cc1cc(OC/C=C\CF)ccc1Sc1ccccc1N |
| InChI | InChI=1S/C19H23FN2OS/c1-22(2)14-15-13-16(23-12-6-5-11-20)9-10-18(15)24-19-8-4-3-7-17(19)21/h3-10,13H,11-12,14,21H2,1-2H3/b6-5- |
| InChIKey | MJLWLHYOTYMDST-WAYWQWQTSA-N |
| XLogP | 4.39 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|